
CAS 1221443-17-9
:(5S)-4-Methyl-4-azaspiro[2.4]heptane-5-methanol
Description:
(5S)-4-Methyl-4-azaspiro[2.4]heptane-5-methanol is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom integrated into a bicyclic framework. The presence of the methyl group at the 4-position and the hydroxymethyl group at the 5-position contributes to its stereochemistry and potential biological activity. This compound may exhibit chiral properties due to the specific configuration at the 5-position, which can influence its interactions in biological systems. As a nitrogen-containing heterocycle, it may participate in various chemical reactions, including nucleophilic substitutions and cyclizations. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and drug design. Its CAS number, 1221443-17-9, allows for precise identification in chemical databases, facilitating research and development in various applications, including pharmaceuticals and agrochemicals. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c1-9-7(6-10)2-3-8(9)4-5-8/h7,10H,2-6H2,1H3/t7-/m0/s1
InChI key:InChIKey=OPJQEXKBNRGOLE-ZETCQYMHSA-N
SMILES:CN1C2(CC[C@H]1CO)CC2
Synonyms:- 4-Azaspiro[2.4]heptane-5-methanol, 4-methyl-, (5S)-
- (S)-(4-Methyl-4-azaspiro[2.4]heptan-5-yl)methanol
- (5S)-4-Methyl-5-(hydroxymethyl)-4-azaspiro[2.4]heptane
- [(5S)-4-Methyl-4-azaspiro[2.4]heptan-5-yl]methanol
- (5S)-4-Methyl-4-azaspiro[2.4]heptane-5-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.