CAS 1221449-51-9

1,1-Dimethylethyl 1-oxo-2,9-diazaspiro[5.5]undecane-2-carboxylate

Description:

1,1-Dimethylethyl 1-oxo-2,9-diazaspiro[5.5]undecane-2-carboxylate, with the CAS number 1221449-51-9, is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a carboxylate functional group. This compound belongs to a class of molecules known for their potential biological activity, often explored in medicinal chemistry for their pharmacological properties. The presence of the dimethyl group contributes to steric hindrance, which can influence the compound's reactivity and interaction with biological targets. The spirocyclic framework may impart rigidity to the molecule, affecting its conformational dynamics and, consequently, its biological activity. Additionally, the oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's structural features suggest potential applications in drug development, although specific biological activities and properties would require further investigation through experimental studies.

Formula: C₁₄H₂₄N₂O₃

InChI: InChI=1S/C14H24N2O3/c1-13(2,3)19-12(18)16-10-4-5-14(11(16)17)6-8-15-9-7-14/h15H,4-10H2,1-3H3

InChI key: InChIKey=BQHIYBZAICVGIF-UHFFFAOYSA-N

SMILES: O=C1C2(CCCN1C(OC(C)(C)C)=O)CCNCC2

Synonyms:

• 1,1-Dimethylethyl 1-oxo-2,9-diazaspiro[5.5]undecane-2-carboxylate
• 2,9-Diazaspiro[5.5]undecane-2-carboxylic acid, 1-oxo-, 1,1-dimethylethyl ester