CymitQuimica logo

CAS 1221502-87-9

:

5,8-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,4-benzoxazin-3(4H)-one

Description:
5,8-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,4-benzoxazin-3(4H)-one is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine core, fluorine substituents, and a boron-containing moiety. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and stability. The dioxaborolane group is known for its utility in organic synthesis, particularly in cross-coupling reactions, making this compound potentially valuable in medicinal chemistry and material science. The benzoxazine structure contributes to its potential as a polymer precursor or in the development of functional materials. Additionally, the compound's unique functional groups may impart specific biological activities, warranting further investigation for applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the intersection of organic synthesis and functional material design, with potential implications in various fields of research and industry.
Formula:C14H16BF2NO4
InChI:InChI=1S/C14H16BF2NO4/c1-13(2)14(3,4)22-15(21-13)7-5-8(16)12-11(10(7)17)18-9(19)6-20-12/h5H,6H2,1-4H3,(H,18,19)
InChI key:InChIKey=MFEBJTMCGUWDLQ-UHFFFAOYSA-N
SMILES:FC=1C(B2OC(C)(C)C(C)(C)O2)=CC(F)=C3C1NC(=O)CO3
Synonyms:
  • 5,8-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,4-benzoxazin-3(4H)-one
  • 2H-1,4-Benzoxazin-3(4H)-one, 5,8-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.