CAS 122155-26-4
:(4-fluorophenyl)(1-methyl-1H-imidazol-2-yl)methanol
Description:
(4-fluorophenyl)(1-methyl-1H-imidazol-2-yl)methanol, with the CAS number 122155-26-4, is an organic compound characterized by the presence of a fluorinated phenyl group and an imidazole moiety. The structure features a hydroxymethyl group attached to the imidazole, which contributes to its potential as a versatile building block in medicinal chemistry. The fluorine atom on the phenyl ring can enhance the compound's lipophilicity and influence its biological activity, making it of interest in drug design. The imidazole ring is known for its role in various biological systems and can participate in hydrogen bonding, which may affect the compound's solubility and reactivity. This compound may exhibit interesting pharmacological properties, and its synthesis typically involves standard organic reactions such as nucleophilic substitutions or coupling reactions. Overall, the unique combination of functional groups in this molecule suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways.
Formula:C11H11FN2O
InChI:InChI=1/C11H11FN2O/c1-14-7-6-13-11(14)10(15)8-2-4-9(12)5-3-8/h2-7,10,15H,1H3
SMILES:Cn1ccnc1C(c1ccc(cc1)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
