CAS 1221573-85-8
:Paritaprevir
Description:
Paritaprevir is an antiviral medication primarily used in the treatment of hepatitis C virus (HCV) infections. It belongs to the class of drugs known as protease inhibitors, specifically targeting the NS3/4A protease enzyme, which is crucial for viral replication. Paritaprevir is often administered in combination with other antiviral agents to enhance its efficacy and reduce the likelihood of resistance. The compound is characterized by its specific molecular structure, which includes a series of functional groups that contribute to its biological activity and solubility. It is typically formulated as part of a fixed-dose combination therapy, often alongside ombitasvir and ritonavir, to improve patient adherence and treatment outcomes. Paritaprevir is generally well-tolerated, but like all medications, it may have side effects, including potential liver enzyme elevations. Its pharmacokinetics involve metabolism primarily through the liver, necessitating careful monitoring in patients with hepatic impairment. Overall, Paritaprevir represents a significant advancement in the management of chronic hepatitis C.
Formula:C40H43N7O7S
InChI:InChI=1S/C40H43N7O7S/c1-24-21-42-33(22-41-24)35(48)43-32-16-6-4-2-3-5-11-25-20-40(25,39(51)46-55(52,53)27-17-18-27)45-36(49)34-19-26(23-47(34)38(32)50)54-37-30-14-8-7-12-28(30)29-13-9-10-15-31(29)44-37/h5,7-15,21-22,25-27,32,34H,2-4,6,16-20,23H2,1H3,(H,43,48)(H,45,49)(H,46,51)/b11-5-/t25-,26-,32+,34+,40-/m1/s1
InChI key:InChIKey=UAUIUKWPKRJZJV-QPLHLKROSA-N
SMILES:C(NS(=O)(=O)C1CC1)(=O)[C@]23[C@@](C2)(/C=C\CCCCC[C@H](NC(=O)C=4C=NC(C)=CN4)C(=O)N5[C@](C(=O)N3)(C[C@@H](OC6=C7C(=C8C(=N6)C=CC=C8)C=CC=C7)C5)[H])[H]
Synonyms:- Cyclopropa[e]pyrrolo[1,2-a][1,4]diazacyclopentadecine-14a(5H)-carboxamide, N-(cyclopropylsulfonyl)-1,2,3,6,7,8,9,10,11,13a,14,15,16,16a-tetradecahydro-6-[[(5-methyl-2-pyrazinyl)carbonyl]amino]-5,16-dioxo-2-(6-phenanthridinyloxy)-, (2R,6S,12Z,13aS,14aR,16aS)-
- (2R,6S,12Z,13aS,14aR,16aS)-N-(Cyclopropylsulfonyl)-1,2,3,6,7,8,9,10,11,13a,14,15,16,16a-tetradecahydro-6-[[(5-methyl-2-pyrazinyl)carbonyl]amino]-5,16-dioxo-2-(6-phenanthridinyloxy)cyclopropa[e]pyrrolo[1,2-a][1,4]diazacyclopentadecine-14a(5H)-carboxamide
- Paritaprevir
- ABT 450
- Veruprevir
- PubChem ID: 45110509
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Paritaprevir free base
CAS:Paritaprevir (ABT-450) is an oral HCV NS3/NS4A protease inhibitor with potential against genotype 1, disrupting viral replication.Formula:C40H43N7O7SPurity:95% - 99.26%Color and Shape:SolidMolecular weight:765.89Paritaprevir
CAS:<p>Paritaprevir is a medicinal compound that acts as an inhibitor of protein kinases. It has been shown to be effective against various types of cancer cells, including those found in the urine and tumors. Paritaprevir is an analog of a Chinese anticancer compound and has been shown to induce apoptosis in human cancer cells. This potent kinase inhibitor selectively targets specific kinases involved in cancer cell proliferation, making it a promising candidate for the treatment of cancer. Its ability to inhibit kinases also makes it an attractive therapeutic option for other diseases that involve aberrant kinase activity.</p>Formula:C40H43N7O7SPurity:Min. 95%Molecular weight:765.9 g/mol


