CAS 122165-90-6
:Poly(o-ethoxyaniline)
Description:
Poly(o-ethoxyaniline) is a conducting polymer derived from the polymerization of o-ethoxyaniline, a substituted aniline compound. This polymer exhibits unique electrical conductivity, which can be attributed to the presence of conjugated double bonds in its structure. It typically appears as a green or blue solid and is soluble in various organic solvents, making it versatile for different applications. The material is known for its environmental stability and can be processed into films, coatings, or composites. Poly(o-ethoxyaniline) also demonstrates interesting electrochemical properties, allowing it to be used in sensors, batteries, and supercapacitors. Its conductivity can be tuned through doping processes, which enhance its performance in electronic applications. Additionally, this polymer has potential uses in organic electronics, such as organic light-emitting diodes (OLEDs) and photovoltaic cells, due to its ability to facilitate charge transport. Overall, poly(o-ethoxyaniline) is a significant material in the field of conductive polymers, combining both chemical stability and electrical properties.
Formula:(C8H11NO)x
InChI:InChI=1S/C8H11NO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2,9H2,1H3
InChI key:InChIKey=ULHFFAFDSSHFDA-UHFFFAOYSA-N
SMILES:O(CC)C1=C(N)C=CC=C1
Synonyms:- Poly(2-ethoxyaniline)
- Poly(o-phenetidine)
- Benzenamine, 2-ethoxy-, homopolymer
- Poly(o-ethoxyaniline)
- 2-Ethoxyaniline homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
