CymitQuimica logo

CAS 122166-15-8

:

31-Hydroxyhentriacontanoic acid

Description:
31-Hydroxyhentriacontanoic acid, with the CAS number 122166-15-8, is a long-chain fatty acid characterized by the presence of a hydroxyl group at the 31st carbon position of a hentriacontanoic acid backbone, which consists of 31 carbon atoms. This compound is part of the class of hydroxy fatty acids, which are known for their unique properties and potential applications in various fields, including biochemistry and materials science. The hydroxyl group introduces polarity, which can enhance solubility in certain solvents and influence the compound's reactivity. Its long hydrocarbon chain contributes to its hydrophobic characteristics, making it relevant in studies related to lipid chemistry and membrane biology. Additionally, such compounds may exhibit biological activities, including antimicrobial or anti-inflammatory properties, although specific biological effects would require further investigation. Overall, 31-Hydroxyhentriacontanoic acid represents a fascinating subject for research in both synthetic and natural product chemistry.
Formula:C31H62O3
InChI:InChI=1S/C31H62O3/c32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31(33)34/h32H,1-30H2,(H,33,34)
InChI key:InChIKey=BSCSQRJIOHAREW-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCCCO)CCCCCCCCCCC(O)=O
Synonyms:
  • 31-Hydroxyhentriacontanoic acid
  • Hentriacontanoic acid, 31-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.