CAS 1221722-11-7

Carbamic acid, N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)-, 2,2,2-trifluoroethyl ester

Description:

Carbamic acid, N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)-, 2,2,2-trifluoroethyl ester, identified by CAS number 1221722-11-7, is a chemical compound characterized by its unique structure that includes a carbamic acid moiety and a trifluoroethyl ester group. This compound features a pyrazole ring, which contributes to its potential biological activity and reactivity. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its pharmacokinetic properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. They may exhibit various biological activities, including anti-inflammatory or analgesic effects, depending on their specific molecular interactions. Additionally, the stability and solubility of this ester can be influenced by the trifluoromethyl group, which can also affect its reactivity in chemical reactions. Overall, this compound represents a class of substances that are of interest in both synthetic and medicinal chemistry due to their diverse properties and potential applications.

Formula: C₁₃H₁₂F₃N₃O₂

InChI: InChI=1S/C13H12F3N3O2/c1-9-7-11(17-12(20)21-8-13(14,15)16)19(18-9)10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,17,20)

InChI key: InChIKey=VUCFIZIRJGWACS-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C=1N(N=C(C)C1)C2=CC=CC=C2

Synonyms:

• Carbamic acid, N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)carbamate