CAS 1221722-16-2

4-Pyridinecarboximidamide, 2-[(1-methyl-1H-imidazol-2-yl)thio]-, hydrochloride (1:1)

Description:

4-Pyridinecarboximidamide, 2-[(1-methyl-1H-imidazol-2-yl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its unique structural features, which include a pyridine ring and an imidazole moiety. This compound typically appears as a hydrochloride salt, indicating it is soluble in water and may exhibit ionic characteristics due to the presence of the hydrochloride group. The presence of the thioether linkage suggests potential reactivity and interactions with various biological systems, making it of interest in medicinal chemistry. Its molecular structure may confer specific pharmacological properties, potentially influencing its activity as a drug candidate. The compound's CAS number, 1221722-16-2, allows for precise identification in chemical databases. As with many nitrogen-containing heterocycles, it may exhibit basicity, allowing it to participate in protonation reactions. Overall, this compound's unique combination of functional groups and heterocyclic rings positions it as a potentially valuable substance in research and pharmaceutical applications.

Formula: C₁₀H₁₁N₅S·ClH

InChI: InChI=1S/C10H11N5S.ClH/c1-15-5-4-14-10(15)16-8-6-7(9(11)12)2-3-13-8;/h2-6H,1H3,(H3,11,12);1H

InChI key: InChIKey=OBBCKHAWXKAFDD-UHFFFAOYSA-N

SMILES: S(C1=CC(C(=N)N)=CC=N1)C=2N(C)C=CN2.Cl

Synonyms:

• 4-Pyridinecarboximidamide, 2-[(1-methyl-1H-imidazol-2-yl)thio]-, hydrochloride (1:1)

2-[(1-Methyl-1H-imidazol-2-yl)sulfanyl]pyridine-4-carboximidamide hydrochloride

CAS: 1221722-16-2

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClN₅S

Purity: Min. 95%

Molecular weight: 269.75 g/mol

Ref: 3D-WYB72216