CAS 1221722-17-3

4-[(2-Methoxyethyl)amino]benzenemethanamine

Description:

4-[(2-Methoxyethyl)amino]benzenemethanamine, identified by its CAS number 1221722-17-3, is an organic compound characterized by the presence of an amine functional group and a methoxyethyl substituent. This compound features a benzene ring, which is a common structural motif in organic chemistry, providing stability and influencing its reactivity. The methoxyethyl group contributes to its solubility in organic solvents and may affect its biological activity. As an amine, it can participate in hydrogen bonding, which may enhance its interactions with biological targets. The presence of both the amine and methoxyethyl groups suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Its molecular structure indicates that it may exhibit moderate polarity, influencing its behavior in various chemical environments. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would be determined by its specific molecular interactions and the presence of functional groups. Overall, this compound's unique structure positions it as a candidate for further investigation in chemical and biological research.

Formula: C₁₀H₁₆N₂O

InChI: InChI=1S/C10H16N2O/c1-13-7-6-12-10-4-2-9(8-11)3-5-10/h2-5,12H,6-8,11H2,1H3

InChI key: InChIKey=SNWVYAKOXVAWFU-UHFFFAOYSA-N

SMILES: N(CCOC)C1=CC=C(CN)C=C1

Synonyms:

• Benzenemethanamine, 4-[(2-methoxyethyl)amino]-
• 4-[(2-Methoxyethyl)amino]benzenemethanamine

4-(Aminomethyl)-N-(2-methoxyethyl)aniline

CAS: 1221722-17-3

Versatile small molecule scaffold

Formula: C₁₀H₁₆N₂O

Purity: Min. 95%

Molecular weight: 180.25 g/mol

Ref: 3D-WYB72217