CAS 1221722-20-8

N-Methyl-3-phenyl-5-isoxazolepropanamine

Description:

N-Methyl-3-phenyl-5-isoxazolepropanamine, identified by its CAS number 1221722-20-8, is a chemical compound that features a unique structure combining an isoxazole ring with a propanamine moiety. This compound is characterized by its potential pharmacological properties, which may include effects on neurotransmitter systems, making it of interest in medicinal chemistry and drug development. The presence of the isoxazole ring contributes to its stability and reactivity, while the methyl and phenyl groups can influence its lipophilicity and biological activity. Typically, compounds of this nature are studied for their interactions with specific receptors or enzymes, which can lead to therapeutic applications. Additionally, the compound's solubility, melting point, and other physical properties would be influenced by its molecular structure, affecting its behavior in biological systems. As with many synthetic compounds, safety and toxicity profiles are essential considerations in its application and research. Overall, N-Methyl-3-phenyl-5-isoxazolepropanamine represents a class of compounds that may hold promise in various scientific and medical fields.

Formula: C₁₃H₁₆N₂O

InChI: InChI=1S/C13H16N2O/c1-14-9-5-8-12-10-13(15-16-12)11-6-3-2-4-7-11/h2-4,6-7,10,14H,5,8-9H2,1H3

InChI key: InChIKey=IJXJJHUDUZWTDT-UHFFFAOYSA-N

SMILES: C(CCNC)C1=CC(=NO1)C2=CC=CC=C2

Synonyms:

• 5-Isoxazolepropanamine, N-methyl-3-phenyl-
• N-Methyl-3-phenyl-5-isoxazolepropanamine

Methyl[3-(3-phenyl-1,2-oxazol-5-yl)propyl]amine

CAS: 1221722-20-8

Versatile small molecule scaffold

Formula: C₁₃H₁₆N₂O

Purity: Min. 95%

Molecular weight: 216.28 g/mol

Ref: 3D-WYB72220