CAS 1221722-21-9

Benzenecarboximidamide, 4-[(cyclohexyloxy)methyl]-, hydrochloride (1:1)

Description:

Benzenecarboximidamide, 4-[(cyclohexyloxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzene ring substituted with a carboximidamide group and a cyclohexyloxy methyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the cyclohexyloxy group suggests potential lipophilicity, which can affect the compound's interaction with biological membranes. The carboximidamide functional group may impart specific reactivity and biological activity, making it of interest in medicinal chemistry. As a hydrochloride, it is likely to be stable under standard conditions, but it may be sensitive to moisture and light. The compound's molecular interactions, including hydrogen bonding and hydrophobic interactions, can play a significant role in its biological activity and potential applications in drug development. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and pharmaceutical contexts.

Formula: C₁₄H₂₀N₂O·ClH

InChI: InChI=1S/C14H20N2O.ClH/c15-14(16)12-8-6-11(7-9-12)10-17-13-4-2-1-3-5-13;/h6-9,13H,1-5,10H2,(H3,15,16);1H

InChI key: InChIKey=BLRMUECNEDEJJN-UHFFFAOYSA-N

SMILES: C(OC1CCCCC1)C2=CC=C(C(=N)N)C=C2.Cl

Synonyms:

• Benzenecarboximidamide, 4-[(cyclohexyloxy)methyl]-, hydrochloride (1:1)

4-[(Cyclohexyloxy)methyl]benzene-1-carboximidamide hydrochloride

CAS: 1221722-21-9

Versatile small molecule scaffold

Formula: C₁₄H₂₁ClN₂O

Purity: Min. 95%

Molecular weight: 268.78 g/mol

Ref: 3D-WYB72221