CymitQuimica logo

CAS 1221722-23-1

:

1,6-Dihydro-4-methyl-6-oxo-2-(2-pyridinyl)-5-pyrimidinepropanoic acid

Description:
1,6-Dihydro-4-methyl-6-oxo-2-(2-pyridinyl)-5-pyrimidinepropanoic acid is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of carboxylic acid functional groups. The presence of the pyridine and pyrimidine rings suggests potential biological activity, possibly as a pharmaceutical agent, given their roles in various biochemical processes. The compound may also display moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as pH and temperature. Additionally, it may participate in various chemical reactions typical of carboxylic acids and heterocyclic compounds, including esterification and nucleophilic substitutions. Its molecular interactions could be influenced by hydrogen bonding due to the functional groups present, making it a candidate for further studies in medicinal chemistry or material science.
Formula:C13H13N3O3
InChI:InChI=1S/C13H13N3O3/c1-8-9(5-6-11(17)18)13(19)16-12(15-8)10-4-2-3-7-14-10/h2-4,7H,5-6H2,1H3,(H,17,18)(H,15,16,19)
InChI key:InChIKey=HAKZQBIYSLCGGZ-UHFFFAOYSA-N
SMILES:CC=1NC(=NC(=O)C1CCC(O)=O)C2=CC=CC=N2
Synonyms:
  • 5-Pyrimidinepropanoic acid, 1,6-dihydro-4-methyl-6-oxo-2-(2-pyridinyl)-
  • 1,6-Dihydro-4-methyl-6-oxo-2-(2-pyridinyl)-5-pyrimidinepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.