CAS 1221722-26-4

Benzenemethanol, α-(aminomethyl)-4-chloro-α-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(aminomethyl)-4-chloro-α-(trifluoromethyl)-, hydrochloride (1:1), with the CAS number 1221722-26-4, is a chemical compound characterized by its complex structure that includes a benzene ring substituted with a chloromethyl group and a trifluoromethyl group, along with an amino group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. The presence of the trifluoromethyl group often imparts unique electronic properties, making it of interest in medicinal chemistry and material science. The amino group can participate in hydrogen bonding, influencing the compound's reactivity and interactions with biological targets. Additionally, the chlorinated and trifluoromethyl substituents can affect the compound's lipophilicity and overall stability. As with many halogenated compounds, it is essential to consider the environmental and health implications associated with its use, particularly regarding toxicity and bioaccumulation.

Formula: C₉H₉ClF₃NO·ClH

InChI: InChI=1S/C9H9ClF3NO.ClH/c10-7-3-1-6(2-4-7)8(15,5-14)9(11,12)13;/h1-4,15H,5,14H2;1H

InChI key: InChIKey=BFIJEORGSJQZLY-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(CN)(O)C1=CC=C(Cl)C=C1.Cl

Synonyms:

• Benzenemethanol, α-(aminomethyl)-4-chloro-α-(trifluoromethyl)-, hydrochloride (1:1)

3-Amino-2-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol hydrochloride

CAS: 1221722-26-4

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₂F₃NO

Purity: Min. 95%

Molecular weight: 276.08 g/mol

Ref: 3D-WYB72226