CymitQuimica logo

CAS 1221722-32-2

:

2H-Pyran-4-carboxamide, 4-(aminomethyl)tetrahydro-, hydrochloride (1:1)

Description:
2H-Pyran-4-carboxamide, 4-(aminomethyl)tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features a carboxamide functional group, indicating the presence of an amide bond, which contributes to its potential biological activity. The addition of an aminomethyl group enhances its reactivity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on its molecular interactions. Its stability, solubility, and reactivity can be influenced by the presence of the hydrochloride moiety. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and drug development, warranting further investigation into its pharmacological properties and applications.
Formula:C7H14N2O2·ClH
InChI:InChI=1S/C7H14N2O2.ClH/c8-5-7(6(9)10)1-3-11-4-2-7;/h1-5,8H2,(H2,9,10);1H
InChI key:InChIKey=BEWQWMQDKJFTAV-UHFFFAOYSA-N
SMILES:C(N)(=O)C1(CN)CCOCC1.Cl
Synonyms:
  • 2H-Pyran-4-carboxamide, 4-(aminomethyl)tetrahydro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.