
CAS 1221722-49-1
:Cyclohexanepropanamine, α-ethyl-, hydrochloride (1:1)
Description:
Cyclohexanepropanamine, α-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclohexane ring structure. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit properties common to amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. The presence of the ethyl group suggests that it may have specific steric and electronic effects, potentially impacting its biological activity and pharmacological properties. Cyclohexane derivatives are often studied for their applications in organic synthesis and medicinal chemistry, as they can serve as intermediates or active pharmaceutical ingredients. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Further research may be necessary to fully understand its characteristics and applications in various fields.
Formula:C11H23N·ClH
InChI:InChI=1S/C11H23N.ClH/c1-2-11(12)9-8-10-6-4-3-5-7-10;/h10-11H,2-9,12H2,1H3;1H
InChI key:InChIKey=IHUXOOTYMVSIDB-UHFFFAOYSA-N
SMILES:C(CC(CC)N)C1CCCCC1.Cl
Synonyms:- Cyclohexanepropanamine, α-ethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.