CAS 1221722-71-9

2-[(Trifluoromethyl)sulfonyl]-3-pyridinecarboxylic acid

Description:

2-[(Trifluoromethyl)sulfonyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its unique functional groups and structure. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with a carboxylic acid group and a trifluoromethylsulfonyl group. The presence of the trifluoromethyl group contributes to its lipophilicity and potential biological activity, while the sulfonyl moiety enhances its reactivity and solubility in polar solvents. This compound is likely to exhibit strong acidity due to the carboxylic acid functional group, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the trifluoromethyl group can influence the compound's electronic properties, potentially affecting its interactions with biological targets. Overall, this compound's distinctive characteristics make it a valuable subject of study in both synthetic and medicinal chemistry.

Formula: C₇H₄F₃NO₄S

InChI: InChI=1S/C7H4F3NO4S/c8-7(9,10)16(14,15)5-4(6(12)13)2-1-3-11-5/h1-3H,(H,12,13)

InChI key: InChIKey=SMPLSZPZRCGNNZ-UHFFFAOYSA-N

SMILES: S(C(F)(F)F)(=O)(=O)C1=C(C(O)=O)C=CC=N1

Synonyms:

• 3-Pyridinecarboxylic acid, 2-[(trifluoromethyl)sulfonyl]-
• 2-Trifluoromethanesulfonylpyridine-3-carboxylic acid
• 2-[(Trifluoromethyl)sulfonyl]-3-pyridinecarboxylic acid

2-Trifluoromethanesulfonylpyridine-3-carboxylic acid

CAS: 1221722-71-9

Versatile small molecule scaffold

Formula: C₇H₄F₃NO₄S

Purity: Min. 95%

Molecular weight: 255.17 g/mol

Ref: 3D-WYB72271