CAS 1221722-72-0

Benzenecarboximidamide, 3-(1H-benzimidazol-1-ylmethyl)-, hydrochloride (1:2)

Description:

Benzenecarboximidamide, 3-(1H-benzimidazol-1-ylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a benzenecarboximidamide moiety and a benzimidazole group. This compound typically appears as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the benzimidazole ring suggests potential biological activity, as benzimidazole derivatives are often associated with various pharmacological effects, including anti-parasitic and anti-cancer properties. The hydrochloride form enhances its stability and solubility, making it suitable for various applications in medicinal chemistry and drug formulation. Additionally, the compound's molecular structure may influence its reactivity, interaction with biological targets, and overall efficacy in therapeutic contexts. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₄N₄·2ClH

InChI: InChI=1S/C15H14N4.2ClH/c16-15(17)12-5-3-4-11(8-12)9-19-10-18-13-6-1-2-7-14(13)19;;/h1-8,10H,9H2,(H3,16,17);2*1H

InChI key: InChIKey=PXNPYIAPDZATLN-UHFFFAOYSA-N

SMILES: C(N1C=2C(N=C1)=CC=CC2)C3=CC(C(=N)N)=CC=C3.Cl

Synonyms:

• Benzenecarboximidamide, 3-(1H-benzimidazol-1-ylmethyl)-, hydrochloride (1:2)