
CAS 1221722-76-4
:Hexanamide, N-4-piperidinyl-, hydrochloride (1:1)
Description:
Hexanamide, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a piperidine ring, which contributes to its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. It may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. The presence of the piperidine moiety often indicates a role in modulating neurotransmitter systems, which could be relevant for central nervous system effects. Safety and handling considerations are essential, as with many chemical substances, and proper laboratory protocols should be followed. Overall, Hexanamide, N-4-piperidinyl-, hydrochloride (1:1) represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C11H22N2O·ClH
InChI:InChI=1S/C11H22N2O.ClH/c1-2-3-4-5-11(14)13-10-6-8-12-9-7-10;/h10,12H,2-9H2,1H3,(H,13,14);1H
InChI key:InChIKey=BSMNNCKBUMROOC-UHFFFAOYSA-N
SMILES:N(C(CCCCC)=O)C1CCNCC1.Cl
Synonyms:- Hexanamide, N-4-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.