CymitQuimica logo

CAS 1221722-80-0

:

2-[3-(2-Bromoethoxy)propyl]-6-methylpyridine

Description:
2-[3-(2-Bromoethoxy)propyl]-6-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a 2-bromoethoxy group, which introduces a bromine atom and an ethoxy chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the propyl group enhances its hydrophobic characteristics, while the methyl group at the 6-position of the pyridine ring can influence its electronic properties and steric hindrance. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. Additionally, the bromine atom can be a site for further chemical modifications, such as nucleophilic substitution reactions. Overall, 2-[3-(2-Bromoethoxy)propyl]-6-methylpyridine is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H16BrNO
InChI:InChI=1S/C11H16BrNO/c1-10-4-2-5-11(13-10)6-3-8-14-9-7-12/h2,4-5H,3,6-9H2,1H3
InChI key:InChIKey=DSWZNHHSBQLGBF-UHFFFAOYSA-N
SMILES:C(CCOCCBr)C=1N=C(C)C=CC1
Synonyms:
  • 2-[3-(2-Bromoethoxy)propyl]-6-methylpyridine
  • Pyridine, 2-[3-(2-bromoethoxy)propyl]-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.