CAS 1221722-98-0

3-Pyridinecarboximidamide, 2-(1-piperidinyl)-, hydrochloride (1:1)

Description:

3-Pyridinecarboximidamide, 2-(1-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyridine ring and a piperidine moiety. This compound typically exists as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the carboximidamide functional group suggests potential biological activity, possibly as an inhibitor or modulator in biochemical pathways. Its molecular structure allows for interactions with biological targets, which may include enzymes or receptors. The compound's hydrochloride form indicates that it is likely to be stable under standard laboratory conditions, although specific handling and storage recommendations should be followed to maintain its integrity. As with many nitrogen-containing heterocycles, it may exhibit properties such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interaction with other molecules. Overall, this compound is of interest in research contexts, particularly in the development of pharmaceuticals.

Formula: C₁₁H₁₆N₄·ClH

InChI: InChI=1S/C11H16N4.ClH/c12-10(13)9-5-4-6-14-11(9)15-7-2-1-3-8-15;/h4-6H,1-3,7-8H2,(H3,12,13);1H

InChI key: InChIKey=DGNWZQHZQOHTIY-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=C(N=CC=C1)N2CCCCC2.Cl

Synonyms:

• 3-Pyridinecarboximidamide, 2-(1-piperidinyl)-, hydrochloride (1:1)