
CAS 1221723-00-7
:3-Pyridinecarboxamide, 2-amino-, hydrochloride (1:1)
Description:
3-Pyridinecarboxamide, 2-amino-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The presence of both the amino and carboxamide groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological activities would depend on further empirical studies. Its molecular structure allows for potential interactions with various biological targets, making it of interest in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be observed, particularly in laboratory settings.
Formula:C6H7N3O·ClH
InChI:InChI=1S/C6H7N3O.ClH/c7-5-4(6(8)10)2-1-3-9-5;/h1-3H,(H2,7,9)(H2,8,10);1H
InChI key:InChIKey=JXJFVVVTJFMUGQ-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(N)N=CC=C1.Cl
Synonyms:- 3-Pyridinecarboxamide, 2-amino-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.