
CAS 1221723-14-3
:Methyl 5-methoxy-2H-1-benzopyran-8-carboxylate
Description:
Methyl 5-methoxy-2H-1-benzopyran-8-carboxylate, identified by its CAS number 1221723-14-3, is a chemical compound belonging to the class of benzopyrans, which are characterized by a fused benzene and pyran ring structure. This compound features a methoxy group at the 5-position and a carboxylate ester at the 8-position, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methoxy group enhances its solubility in organic solvents, while the carboxylate moiety can participate in various chemical reactions, including esterification and nucleophilic substitutions. Methyl 5-methoxy-2H-1-benzopyran-8-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its stability, reactivity, and potential applications in synthesis or as a pharmaceutical intermediate are areas of ongoing research. As with any chemical, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C12H12O4
InChI:InChI=1S/C12H12O4/c1-14-10-6-5-9(12(13)15-2)11-8(10)4-3-7-16-11/h3-6H,7H2,1-2H3
InChI key:InChIKey=QJLHSHUYUUHFRU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=C(OC)C=C1)C=CCO2
Synonyms:- 2H-1-Benzopyran-8-carboxylic acid, 5-methoxy-, methyl ester
- Methyl 5-methoxy-2H-1-benzopyran-8-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.