
CAS 1221723-17-6
:2-(Methylsulfonyl)cyclopentanamine
Description:
2-(Methylsulfonyl)cyclopentanamine is an organic compound characterized by the presence of a cyclopentane ring substituted with a methylsulfonyl group and an amine functional group. The methylsulfonyl group, which consists of a sulfur atom bonded to three oxygen atoms and a methyl group, imparts unique properties to the molecule, including potential polar characteristics and the ability to participate in various chemical reactions. The amine group contributes basicity and nucleophilicity, making the compound potentially reactive in organic synthesis. This compound may exhibit solubility in polar solvents due to its functional groups, and its structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often relevant. Additionally, the presence of the cyclopentane ring may influence the compound's conformational flexibility and steric interactions, which are important in determining its biological activity and reactivity. Overall, 2-(Methylsulfonyl)cyclopentanamine is a compound of interest for further study in various chemical and biological contexts.
Formula:C6H13NO2S
InChI:InChI=1S/C6H13NO2S/c1-10(8,9)6-4-2-3-5(6)7/h5-6H,2-4,7H2,1H3
InChI key:InChIKey=GKPNHSIGALZAJP-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1C(N)CCC1
Synonyms:- 2-(Methylsulfonyl)cyclopentanamine
- Cyclopentanamine, 2-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.