CAS 1221723-30-3

Pyrimidine, 2-(methoxymethyl)-4-(3-piperidinyl)-, hydrochloride (1:2)

Description:

Pyrimidine, 2-(methoxymethyl)-4-(3-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a methoxymethyl group at the 2-position and a piperidinyl group at the 4-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand for specific receptors or enzymes due to the functional groups present. Its molecular interactions and stability can be influenced by factors such as pH and temperature. As with many pyrimidine derivatives, it may be of interest in medicinal chemistry for the development of therapeutic agents, particularly in the fields of neurology or oncology. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₇N₃O·2ClH

InChI: InChI=1S/C11H17N3O.2ClH/c1-15-8-11-13-6-4-10(14-11)9-3-2-5-12-7-9;;/h4,6,9,12H,2-3,5,7-8H2,1H3;2*1H

InChI key: InChIKey=WXDFORHJKCPOBE-UHFFFAOYSA-N

SMILES: C(OC)C=1N=C(C=CN1)C2CCCNC2.Cl

Synonyms:

• Pyrimidine, 2-(methoxymethyl)-4-(3-piperidinyl)-, hydrochloride (1:2)