CAS 1221723-37-0

2-Amino-4-chloro-1-phenyl-1H-imidazole-5-carboxaldehyde

Description:

2-Amino-4-chloro-1-phenyl-1H-imidazole-5-carboxaldehyde is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group (-NH2) and a chloro substituent (-Cl) at specific positions on the imidazole ring, contributing to its reactivity and potential biological activity. The presence of a phenyl group indicates that it has an aromatic character, which can influence its interactions in various chemical environments. Additionally, the aldehyde functional group (-CHO) at the 5-position of the imidazole ring allows for further reactivity, particularly in condensation reactions. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its unique structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many chemical substances, safety and handling precautions should be observed due to its potential biological effects.

Formula: C₁₀H₈ClN₃O

InChI: InChI=1S/C10H8ClN3O/c11-9-8(6-15)14(10(12)13-9)7-4-2-1-3-5-7/h1-6H,(H2,12,13)

InChI key: InChIKey=KUPFMGQMOAYLPW-UHFFFAOYSA-N

SMILES: C(=O)C=1N(C(N)=NC1Cl)C2=CC=CC=C2

Synonyms:

• 2-Amino-4-chloro-1-phenyl-1H-imidazole-5-carboxaldehyde
• 2-Amino-4-chloro-1-phenyl-1H-imidazole-5-carbaldehyde
• 1H-Imidazole-5-carboxaldehyde, 2-amino-4-chloro-1-phenyl-