CAS 1221723-38-1

2-(4-Bromophenyl)-4-thiazolesulfonyl chloride

Description:

2-(4-Bromophenyl)-4-thiazolesulfonyl chloride is a chemical compound characterized by its thiazole and sulfonyl chloride functional groups. It features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromophenyl group enhances its electrophilic properties, making it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. As a sulfonyl chloride, it is highly reactive, especially towards nucleophiles, and can participate in acylation reactions. This compound is typically handled with care due to its potential to release hydrochloric acid upon hydrolysis, which can lead to corrosive effects. Its applications may include serving as an intermediate in the synthesis of more complex molecules, and it may also exhibit biological activity, although specific biological properties would require further investigation. Overall, its unique structural features make it a valuable compound in synthetic organic chemistry.

Formula: C₉H₅BrClNO₂S₂

InChI: InChI=1S/C9H5BrClNO2S2/c10-7-3-1-6(2-4-7)9-12-8(5-15-9)16(11,13)14/h1-5H

InChI key: InChIKey=CZVFJQCMMUZTKX-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1N=C(SC1)C2=CC=C(Br)C=C2

Synonyms:

• 4-Thiazolesulfonyl chloride, 2-(4-bromophenyl)-
• 2-(4-Bromophenyl)-4-thiazolesulfonyl chloride
• 2-(4-Bromophenyl)-1,3-thiazole-4-sulfonyl chloride