CAS 1221723-46-1

5,6,7,8-Tetrahydro-3-methyl-1,2,4-triazolo[4,3-a]pyridine-6-carboxylic acid hydrazide

Description:

5,6,7,8-Tetrahydro-3-methyl-1,2,4-triazolo[4,3-a]pyridine-6-carboxylic acid hydrazide is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyridine moiety. This compound typically exhibits properties associated with both hydrazides and triazoles, such as potential biological activity, including antimicrobial and anti-inflammatory effects. The presence of the carboxylic acid group suggests it may participate in acid-base reactions, while the hydrazide functionality can engage in various chemical transformations, including condensation reactions. Its molecular structure contributes to its solubility in polar solvents, and it may exhibit moderate stability under standard laboratory conditions. The compound's unique arrangement of nitrogen and carbon atoms allows for diverse interactions, making it of interest in medicinal chemistry and drug development. As with many heterocycles, its reactivity and biological properties can be influenced by substituents and the overall electronic environment of the molecule. Further studies would be necessary to fully elucidate its potential applications and mechanisms of action.

Formula: C₈H₁₃N₅O

InChI: InChI=1S/C8H13N5O/c1-5-11-12-7-3-2-6(4-13(5)7)8(14)10-9/h6H,2-4,9H2,1H3,(H,10,14)

InChI key: InChIKey=NSVWLUNPKMVWSH-UHFFFAOYSA-N

SMILES: CC=1N2C(CCC(C(NN)=O)C2)=NN1

Synonyms:

• 5,6,7,8-Tetrahydro-3-methyl-1,2,4-triazolo[4,3-a]pyridine-6-carboxylic acid hydrazide
• 1,2,4-Triazolo[4,3-a]pyridine-6-carboxylic acid, 5,6,7,8-tetrahydro-3-methyl-, hydrazide