CAS 1221723-48-3

Methanone, (2,3-dimethoxyphenyl)-1-piperazinyl-, hydrochloride (1:1)

Description:

Methanone, (2,3-dimethoxyphenyl)-1-piperazinyl-, hydrochloride (1:1), with CAS number 1221723-48-3, is a chemical compound characterized by its piperazine moiety and a methanone functional group. This substance typically exhibits properties associated with both piperazine derivatives and aromatic compounds, including potential psychoactive effects due to its structural similarity to various neurotransmitter modulators. The presence of the dimethoxyphenyl group suggests that it may have enhanced lipophilicity, which can influence its bioavailability and interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, facilitating its use in pharmaceutical applications. The compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities and safety profiles would require further investigation through empirical studies. Overall, its unique structure positions it as a candidate for research in drug development, particularly in areas related to central nervous system activity.

Formula: C₁₃H₁₈N₂O₃·ClH

InChI: InChI=1S/C13H18N2O3.ClH/c1-17-11-5-3-4-10(12(11)18-2)13(16)15-8-6-14-7-9-15;/h3-5,14H,6-9H2,1-2H3;1H

InChI key: InChIKey=JSUVLJZEBFRDPA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C(OC)=CC=C1)N2CCNCC2.Cl

Synonyms:

• Methanone, (2,3-dimethoxyphenyl)-1-piperazinyl-, hydrochloride (1:1)

1-(2,3-Dimethoxybenzoyl)piperazine hydrochloride

CAS: 1221723-48-3

Versatile small molecule scaffold

Formula: C₁₃H₁₉ClN₂O₃

Purity: Min. 95%

Molecular weight: 286.75 g/mol

Ref: 3D-WYB72348