CAS 1221723-57-4

2,2,2-Trifluoroethyl N-[2-(1H-pyrazol-1-yl)-3-pyridinyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[2-(1H-pyrazol-1-yl)-3-pyridinyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate moiety linked to a pyridine and pyrazole derivative. This compound is notable for its potential biological activity, particularly in the field of pharmaceuticals, where it may exhibit properties such as anti-inflammatory or anti-cancer effects. The presence of the trifluoroethyl group enhances lipophilicity, potentially improving the compound's ability to penetrate biological membranes. Additionally, the pyrazole and pyridine rings contribute to its pharmacological profile, possibly influencing receptor interactions or enzyme inhibition. The compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry. Safety and handling considerations are essential due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, this compound exemplifies the complexity and potential utility of fluorinated organic molecules in drug design and development.

Formula: C₁₁H₉F₃N₄O₂

InChI: InChI=1S/C11H9F3N4O2/c12-11(13,14)7-20-10(19)17-8-3-1-4-15-9(8)18-6-2-5-16-18/h1-6H,7H2,(H,17,19)

InChI key: InChIKey=HCTAPROPEIAERV-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=C(N=CC=C1)N2C=CC=N2

Synonyms:

• 2,2,2-Trifluoroethyl N-[2-(1H-pyrazol-1-yl)-3-pyridinyl]carbamate
• Carbamic acid, N-[2-(1H-pyrazol-1-yl)-3-pyridinyl]-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(2-pyrazol-1-ylpyridin-3-yl)carbamate

2,2,2-Trifluoroethyl N-[2-(1H-pyrazol-1-yl)pyridin-3-yl]carbamate

CAS: 1221723-57-4

Versatile small molecule scaffold

Formula: C₁₁H₉F₃N₄O₂

Purity: Min. 95%

Molecular weight: 286.21 g/mol

Ref: 3D-WYB72357