CAS 1221723-60-9

3-Pyridinepropanoic acid, α-(aminomethyl)-, ethyl ester, hydrochloride (1:2)

Description:

3-Pyridinepropanoic acid, α-(aminomethyl)-, ethyl ester, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the propanoic acid moiety indicates that it has carboxylic acid characteristics, while the ethyl ester suggests it is a derivative that may exhibit different solubility and reactivity compared to its acid form. The hydrochloride salt form enhances its solubility in water, making it more bioavailable for pharmaceutical applications. This compound may possess various functional groups, including an amine, which can participate in hydrogen bonding and influence its interaction with biological targets. Its potential applications could span across medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways, given the structural features that suggest possible interactions with neurotransmitter systems. As with many compounds, its safety, efficacy, and specific applications would require thorough investigation through experimental studies and clinical trials.

Formula: C₁₁H₁₆N₂O₂·2ClH

InChI: InChI=1S/C11H16N2O2.2ClH/c1-2-15-11(14)10(7-12)6-9-4-3-5-13-8-9;;/h3-5,8,10H,2,6-7,12H2,1H3;2*1H

InChI key: InChIKey=RKEBZTVRFOSNTO-UHFFFAOYSA-N

SMILES: C(CC=1C=CC=NC1)(C(OCC)=O)CN.Cl

Synonyms:

• 3-Pyridinepropanoic acid, α-(aminomethyl)-, ethyl ester, hydrochloride (1:2)

Ethyl 3-amino-2-(pyridin-3-ylmethyl)propanoate dihydrochloride

CAS: 1221723-60-9

Purity: 98%

Molecular weight: 281.1799927

Ref: 10-F666021