
CAS 1221723-70-1
:2,2,2-Trifluoroethyl N-[6-(1-pyrrolidinyl)-3-pyridinyl]carbamate
Description:
2,2,2-Trifluoroethyl N-[6-(1-pyrrolidinyl)-3-pyridinyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a pyridine derivative. This compound features a carbamate functional group, which is known for its potential applications in medicinal chemistry, particularly as a pharmacological agent. The presence of the trifluoroethyl group enhances lipophilicity and metabolic stability, making it an interesting candidate for drug development. The pyridine ring contributes to the compound's ability to interact with biological targets, potentially influencing its pharmacodynamics and pharmacokinetics. Additionally, the pyrrolidine moiety may enhance binding affinity to specific receptors or enzymes. Overall, this compound's characteristics suggest it may exhibit significant biological activity, warranting further investigation in the context of therapeutic applications. As with any chemical substance, safety and handling precautions should be observed, and its properties should be evaluated in the context of relevant regulatory guidelines.
Formula:C12H14F3N3O2
InChI:InChI=1S/C12H14F3N3O2/c13-12(14,15)8-20-11(19)17-9-3-4-10(16-7-9)18-5-1-2-6-18/h3-4,7H,1-2,5-6,8H2,(H,17,19)
InChI key:InChIKey=JTTIVCJJQWNFKZ-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC=C(N=C1)N2CCCC2
Synonyms:- Carbamic acid, N-[6-(1-pyrrolidinyl)-3-pyridinyl]-, 2,2,2-trifluoroethyl ester
- 2,2,2-Trifluoroethyl N-[6-(1-pyrrolidinyl)-3-pyridinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.