
CAS 1221723-72-3
:2-Imidazolidinone, 1-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)
Description:
2-Imidazolidinone, 1-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its imidazolidinone core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a piperazine moiety, a six-membered ring containing two nitrogen atoms, which is linked to an ethyl group. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of both imidazolidinone and piperazine suggests potential biological activity, possibly as a pharmaceutical agent, due to the ability of these structures to interact with biological targets. The compound's molecular properties, such as its solubility, stability, and reactivity, are influenced by the functional groups present and the overall molecular architecture. As with many compounds in medicinal chemistry, its specific characteristics, including pharmacokinetics and pharmacodynamics, would require further investigation through experimental studies.
Formula:C9H18N4O·2ClH
InChI:InChI=1S/C9H18N4O.2ClH/c14-9-11-3-6-13(9)8-7-12-4-1-10-2-5-12;;/h10H,1-8H2,(H,11,14);2*1H
InChI key:InChIKey=DTAANFHGMDMUTH-UHFFFAOYSA-N
SMILES:C(CN1CCNCC1)N2C(=O)NCC2.Cl
Synonyms:- 2-Imidazolidinone, 1-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.