CAS 1221723-74-5

2,2,2-Trifluoroethyl N-(3-acetylphenyl)carbamate

Description:

2,2,2-Trifluoroethyl N-(3-acetylphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. The presence of the trifluoroethyl moiety imparts significant lipophilicity and potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The N-(3-acetylphenyl) portion indicates that the compound has an aromatic ring substituted with an acetyl group, which can influence its reactivity and interaction with biological targets. This compound may exhibit properties such as stability under certain conditions, but its reactivity can vary depending on the surrounding environment and functional groups present. Additionally, the trifluoromethyl groups are known to enhance metabolic stability and alter the pharmacokinetic properties of compounds. Overall, 2,2,2-Trifluoroethyl N-(3-acetylphenyl)carbamate represents a complex molecule with potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.

Formula: C₁₁H₁₀F₃NO₃

InChI: InChI=1S/C11H10F3NO3/c1-7(16)8-3-2-4-9(5-8)15-10(17)18-6-11(12,13)14/h2-5H,6H2,1H3,(H,15,17)

InChI key: InChIKey=XXAHZDAIWGQECU-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC(C(C)=O)=CC=C1

Synonyms:

• Carbamic acid, N-(3-acetylphenyl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(3-acetylphenyl)carbamate

2,2,2-Trifluoroethyl N-(3-acetylphenyl)carbamate

CAS: 1221723-74-5

Versatile small molecule scaffold

Formula: C₁₁H₁₀F₃NO₃

Purity: Min. 95%

Molecular weight: 261.2 g/mol

Ref: 3D-WYB72374