CAS 1221723-79-0

Methyl 5,7-difluoro-2H-1-benzopyran-8-carboxylate

Description:

Methyl 5,7-difluoro-2H-1-benzopyran-8-carboxylate is a synthetic organic compound characterized by its unique structure, which includes a benzopyran moiety with two fluorine substituents at the 5 and 7 positions and a carboxylate group at the 8 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic benzopyran structure. The presence of fluorine atoms can enhance the compound's stability and lipophilicity, making it of interest in medicinal chemistry and material science. Methyl 5,7-difluoro-2H-1-benzopyran-8-carboxylate may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. As with many fluorinated compounds, it may also possess unique electronic properties that could be exploited in various applications, including fluorescence and photonic devices. Safety data should be consulted for handling and usage guidelines.

Formula: C₁₁H₈F₂O₃

InChI: InChI=1S/C11H8F2O3/c1-15-11(14)9-8(13)5-7(12)6-3-2-4-16-10(6)9/h2-3,5H,4H2,1H3

InChI key: InChIKey=YEAUTGNGKDIHNK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=C(F)C=C1F)C=CCO2

Synonyms:

• Methyl 5,7-difluoro-2H-1-benzopyran-8-carboxylate
• 2H-1-Benzopyran-8-carboxylic acid, 5,7-difluoro-, methyl ester