CAS 1221723-95-0

6,8-Dichloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid

Description:

6,8-Dichloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its triazole and pyridine rings, which contribute to its unique chemical properties. This compound features two chlorine substituents at the 6 and 8 positions of the triazole ring, enhancing its reactivity and potential biological activity. The carboxylic acid functional group at the 3-position provides acidic properties, allowing for hydrogen bonding and interactions with biological targets. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agrochemicals or medicinal compounds due to its ability to interact with various biological systems. The presence of chlorine atoms may also influence its lipophilicity and solubility, affecting its bioavailability. Additionally, the compound's stability and reactivity can be influenced by environmental factors, making it important to consider these aspects in practical applications. Overall, 6,8-Dichloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₇H₃Cl₂N₃O₂

InChI: InChI=1S/C7H3Cl2N3O2/c8-3-1-4(9)5-10-11-6(7(13)14)12(5)2-3/h1-2H,(H,13,14)

InChI key: InChIKey=IDYNUTOANPAAMF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NN1)C(Cl)=CC(Cl)=C2

Synonyms:

• 6,8-Dichloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid
• 1,2,4-Triazolo[4,3-a]pyridine-3-carboxylic acid, 6,8-dichloro-