CAS 1221723-96-1

Thiazolo[2,3-c][1,2,4]thiadiazine-7-carboxylic acid, 3,4-dihydro-6-phenyl-, 2,2-dioxide

Description:

Thiazolo[2,3-c][1,2,4]thiadiazine-7-carboxylic acid, 3,4-dihydro-6-phenyl-, 2,2-dioxide, identified by CAS number 1221723-96-1, is a heterocyclic compound characterized by a fused ring system that includes both thiazole and thiadiazine moieties. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the 3,4-dihydro structure indicates that it has a saturated ring system, while the phenyl group enhances its aromatic character and may influence its solubility and interaction with biological systems. The 2,2-dioxide functionality suggests the presence of two double-bonded oxygen atoms, which can affect the compound's electronic properties and reactivity. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features could lead to diverse applications, particularly in the synthesis of novel therapeutic agents.

Formula: C₁₂H₁₀N₂O₄S₂

InChI: InChI=1S/C12H10N2O4S2/c15-11(16)10-9(8-4-2-1-3-5-8)14-6-7-20(17,18)13-12(14)19-10/h1-5H,6-7H2,(H,15,16)

InChI key: InChIKey=PULZBSDJPIMYKA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N2C(S1)=NS(=O)(=O)CC2)C3=CC=CC=C3

Synonyms:

• Thiazolo[2,3-c][1,2,4]thiadiazine-7-carboxylic acid, 3,4-dihydro-6-phenyl-, 2,2-dioxide

2,2-dioxo-6-phenyl-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazine-7-carboxylic acid

CAS: 1221723-96-1

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₂O₄S₂

Purity: Min. 95%

Molecular weight: 310.4 g/mol

Ref: 3D-WYB72396