CAS 1221724-05-5

4-Pyridinecarboximidamide, 2-(4-ethoxyphenoxy)-, hydrochloride (1:1)

Description:

4-Pyridinecarboximidamide, 2-(4-ethoxyphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its unique structural features, which include a pyridine ring and an ethoxyphenoxy group. The presence of the carboximidamide functional group contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in drug development and research. Its molecular interactions can be influenced by the functional groups present, which may affect its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a specific class of organic molecules that can be explored for various applications in chemistry and related fields.

Formula: C₁₄H₁₅N₃O₂·ClH

InChI: InChI=1S/C14H15N3O2.ClH/c1-2-18-11-3-5-12(6-4-11)19-13-9-10(14(15)16)7-8-17-13;/h3-9H,2H2,1H3,(H3,15,16);1H

InChI key: InChIKey=IBHMGYLPUSQNOU-UHFFFAOYSA-N

SMILES: O(C1=CC(C(=N)N)=CC=N1)C2=CC=C(OCC)C=C2.Cl

Synonyms:

• 4-Pyridinecarboximidamide, 2-(4-ethoxyphenoxy)-, hydrochloride (1:1)
• 2-(4-ethoxyphenoxy)pyridine-4-carboximidamide hydrochloride

2-(4-Ethoxyphenoxy)pyridine-4-carboximidamide hydrochloride

CAS: 1221724-05-5

Versatile small molecule scaffold

Formula: C₁₄H₁₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 293.75 g/mol

Ref: 3D-WYB72405