CAS 1221724-09-9

Benzeneacetamide, 4-amino-N-(2-hydroxyethyl)-, hydrochloride (1:1)

Description:

Benzeneacetamide, 4-amino-N-(2-hydroxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a benzene ring, which contributes to its aromatic properties. The compound features an amino group and a hydroxyethyl substituent, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the amino group suggests potential for biological activity, possibly interacting with various biological targets. This compound may be utilized in medicinal chemistry, particularly in the development of drugs due to its structural characteristics. Its CAS number, 1221724-09-9, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, the unique structural features of this compound make it of interest in both research and application contexts.

Formula: C₁₀H₁₄N₂O₂·ClH

InChI: InChI=1S/C10H14N2O2.ClH/c11-9-3-1-8(2-4-9)7-10(14)12-5-6-13;/h1-4,13H,5-7,11H2,(H,12,14);1H

InChI key: InChIKey=ZZRHSLYEAGHRFJ-UHFFFAOYSA-N

SMILES: C(C(NCCO)=O)C1=CC=C(N)C=C1.Cl

Synonyms:

• Benzeneacetamide, 4-amino-N-(2-hydroxyethyl)-, hydrochloride (1:1)

2-(4-Aminophenyl)-N-(2-hydroxyethyl)acetamide hydrochloride

CAS: 1221724-09-9

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 230.69 g/mol

Ref: 3D-WYB72409