CAS 1221724-22-6

α-(Aminomethyl)-α-(trifluoromethyl)-1H-indole-3-methanol

Description:

α-(Aminomethyl)-α-(trifluoromethyl)-1H-indole-3-methanol is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an aminomethyl group and a trifluoromethyl group, which significantly influence its chemical reactivity and biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The hydroxymethyl group at the indole position can participate in hydrogen bonding, potentially affecting the compound's solubility and interaction with biological targets. This compound may exhibit various pharmacological properties, making it a candidate for research in drug development. Its specific applications and effects would depend on further studies, including its mechanism of action and potential therapeutic uses. As with many indole derivatives, it may also be subject to various synthetic routes for its preparation, highlighting its relevance in organic synthesis and pharmaceutical chemistry.

Formula: C₁₁H₁₁F₃N₂O

InChI: InChI=1S/C11H11F3N2O/c12-11(13,14)10(17,6-15)8-5-16-9-4-2-1-3-7(8)9/h1-5,16-17H,6,15H2

InChI key: InChIKey=ADKNARNQNHGXIL-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(CN)(O)C=1C=2C(NC1)=CC=CC2

Synonyms:

• α-(Aminomethyl)-α-(trifluoromethyl)-1H-indole-3-methanol
• 1H-Indole-3-methanol, α-(aminomethyl)-α-(trifluoromethyl)-