CAS 1221724-29-3

Benzenesulfonamide, 4-amino-N-cyclopropyl-, hydrochloride (1:1)

Description:

Benzenesulfonamide, 4-amino-N-cyclopropyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a cyclopropyl group attached to the nitrogen of the sulfonamide, contributing to its unique pharmacological profile. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is beneficial for biological applications. The presence of the amino group further suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Typically, compounds of this nature are investigated for their efficacy in treating various conditions, including bacterial infections and possibly other therapeutic areas. Its molecular structure allows for specific interactions with enzymes or receptors, which can influence its biological activity. As with many sulfonamides, it may exhibit a range of effects, including antibacterial, anti-inflammatory, or diuretic properties, depending on its specific interactions within biological systems. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₉H₁₂N₂O₂S·ClH

InChI: InChI=1S/C9H12N2O2S.ClH/c10-7-1-5-9(6-2-7)14(12,13)11-8-3-4-8;/h1-2,5-6,8,11H,3-4,10H2;1H

InChI key: InChIKey=BMWIMHHVJZRRKL-UHFFFAOYSA-N

SMILES: S(NC1CC1)(=O)(=O)C2=CC=C(N)C=C2.Cl

Synonyms:

• Benzenesulfonamide, 4-amino-N-cyclopropyl-, hydrochloride (1:1)