CAS 1221724-40-8

2-Benzofuranmethanamine, 3-ethyl-α-methyl-, hydrochloride (1:1)

Description:

2-Benzofuranmethanamine, 3-ethyl-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an amine functional group. This compound typically appears as a hydrochloride salt, indicating that it is a protonated form of the amine, which enhances its solubility in water and other polar solvents. The presence of the ethyl and α-methyl groups contributes to its steric and electronic properties, potentially influencing its biological activity and interaction with receptors. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific details regarding its reactivity, toxicity, and applications would require further investigation through empirical studies and literature review. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research and development.

Formula: C₁₂H₁₅NO·ClH

InChI: InChI=1S/C12H15NO.ClH/c1-3-9-10-6-4-5-7-11(10)14-12(9)8(2)13;/h4-8H,3,13H2,1-2H3;1H

InChI key: InChIKey=GVWDLNCTGYMKGH-UHFFFAOYSA-N

SMILES: C(C)C=1C=2C(OC1C(C)N)=CC=CC2.Cl

Synonyms:

• 2-Benzofuranmethanamine, 3-ethyl-α-methyl-, hydrochloride (1:1)