CAS 1221724-44-2

Benzenamine, 4-[(2-fluorophenyl)methoxy]-, hydrochloride (1:1)

Description:

Benzenamine, 4-[(2-fluorophenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a methoxy linkage to a fluorophenyl group. This compound features a benzene ring substituted at the para position with an amine group, which contributes to its basicity and potential reactivity. The presence of the 2-fluorophenyl moiety introduces additional electronic effects due to the fluorine atom, which can influence the compound's reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The hydrochloride form also stabilizes the amine, making it easier to handle and store. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₃H₁₂FNO·ClH

InChI: InChI=1S/C13H12FNO.ClH/c14-13-4-2-1-3-10(13)9-16-12-7-5-11(15)6-8-12;/h1-8H,9,15H2;1H

InChI key: InChIKey=WMDZKSGXNSTUSD-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(N)C=C1)C2=C(F)C=CC=C2.Cl

Synonyms:

• Benzenamine, 4-[(2-fluorophenyl)methoxy]-, hydrochloride (1:1)

4-[(2-Fluorophenyl)methoxy]aniline hydrochloride

CAS: 1221724-44-2

Versatile small molecule scaffold

Formula: C₁₃H₁₃ClFNO

Purity: Min. 95%

Molecular weight: 253.7 g/mol

Ref: 3D-WYB72444