CAS 1221724-47-5

2,2,2-Trifluoroethyl N-[5-(2-pyridinyl)-1,3,4-thiadiazol-2-yl]carbamate

Description:

2,2,2-Trifluoroethyl N-[5-(2-pyridinyl)-1,3,4-thiadiazol-2-yl]carbamate is a chemical compound characterized by its unique structural features, which include a trifluoroethyl group and a thiadiazole moiety linked to a pyridine ring. This compound typically exhibits properties associated with both the trifluoroethyl group, such as increased lipophilicity and potential bioactivity, and the thiadiazole and pyridine components, which may contribute to its biological activity and interaction with various biological targets. The presence of the carbamate functional group suggests potential for reactivity and stability under certain conditions. Additionally, the compound may display specific solubility characteristics, depending on the solvent system used, and could be of interest in pharmaceutical applications due to its potential as a bioactive agent. Its CAS number, 1221724-47-5, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status in chemical databases. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and agrochemical research.

Formula: C₁₀H₇F₃N₄O₂S

InChI: InChI=1S/C10H7F3N4O2S/c11-10(12,13)5-19-9(18)15-8-17-16-7(20-8)6-3-1-2-4-14-6/h1-4H,5H2,(H,15,17,18)

InChI key: InChIKey=UPDVFAXOVGGIIE-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C=1SC(=NN1)C2=CC=CC=N2

Synonyms:

• Carbamic acid, N-[5-(2-pyridinyl)-1,3,4-thiadiazol-2-yl]-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-[5-(2-pyridinyl)-1,3,4-thiadiazol-2-yl]carbamate

2,2,2-Trifluoroethyl N-[5-(pyridin-2-yl)-1,3,4-thiadiazol-2-yl]carbamate

CAS: 1221724-47-5

Versatile small molecule scaffold

Formula: C₁₀H₇F₃N₄O₂S

Purity: Min. 95%

Molecular weight: 304.25 g/mol

Ref: 3D-WYB72447