CymitQuimica logo

CAS 1221724-48-6

:

3-Chloro-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile

Description:
3-Chloro-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 3-position and a cyclopropylmethoxy group at the 6-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carbonitrile functional group at the 2-position enhances its polarity and can influence its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in drug development. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the cyclopropyl group may impart specific steric and electronic effects, influencing the compound's biological activity. As with many pyridine derivatives, it may also exhibit properties such as antimicrobial or anti-inflammatory activities, warranting investigation in various fields of chemistry and pharmacology.
Formula:C10H9ClN2O
InChI:InChI=1S/C10H9ClN2O/c11-8-3-4-10(13-9(8)5-12)14-6-7-1-2-7/h3-4,7H,1-2,6H2
InChI key:InChIKey=MVAAFTUKYKGJRU-UHFFFAOYSA-N
SMILES:O(CC1CC1)C=2N=C(C#N)C(Cl)=CC2
Synonyms:
  • 2-Pyridinecarbonitrile, 3-chloro-6-(cyclopropylmethoxy)-
  • 3-Chloro-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.