CAS 1221724-53-3

Benzenesulfonamide, N-(2-aminoethyl)-3-nitro-, hydrochloride (1:1)

Description:

Benzenesulfonamide, N-(2-aminoethyl)-3-nitro-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the nitro group indicates potential reactivity and biological activity, often associated with pharmaceuticals. This compound features an aminoethyl side chain, which can enhance solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including medicinal chemistry. The molecular structure suggests potential uses in drug development, particularly in the synthesis of compounds with antimicrobial or anti-inflammatory properties. Additionally, the compound's properties may include moderate to high melting points and specific solubility characteristics in organic solvents. Safety data should be consulted for handling and usage, as sulfonamides can exhibit toxicity and allergic reactions in some individuals. Overall, this compound represents a class of sulfonamide derivatives with potential therapeutic applications.

Formula: C₈H₁₁N₃O₄S·ClH

InChI: InChI=1S/C8H11N3O4S.ClH/c9-4-5-10-16(14,15)8-3-1-2-7(6-8)11(12)13;/h1-3,6,10H,4-5,9H2;1H

InChI key: InChIKey=AEXMQVCRAWKUDT-UHFFFAOYSA-N

SMILES: S(NCCN)(=O)(=O)C1=CC(N(=O)=O)=CC=C1.Cl

Synonyms:

• Benzenesulfonamide, N-(2-aminoethyl)-3-nitro-, hydrochloride (1:1)

N-(2-Aminoethyl)-3-nitrobenzene-1-sulfonamide hydrochloride

CAS: 1221724-53-3

Versatile small molecule scaffold

Formula: C₈H₁₂ClN₃O₄S

Purity: Min. 95%

Molecular weight: 281.72 g/mol

Ref: 3D-WYB72453