CAS 1221724-56-6

2,2,2-Trifluoroethyl N-[3-(2-methyl-4-thiazolyl)phenyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[3-(2-methyl-4-thiazolyl)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically used in agricultural applications, particularly as a pesticide or herbicide, due to its ability to inhibit specific biological pathways in target organisms. The presence of the thiazole ring contributes to its biological activity, enhancing its effectiveness against pests. The trifluoroethyl group imparts distinct physical properties, such as increased lipophilicity, which can influence the compound's absorption and distribution in biological systems. Additionally, the compound's stability and reactivity are influenced by the carbamate moiety, which can undergo hydrolysis under certain conditions. Safety and environmental impact assessments are crucial for compounds like this, as they may pose risks to non-target organisms and ecosystems. Overall, 2,2,2-Trifluoroethyl N-[3-(2-methyl-4-thiazolyl)phenyl]carbamate exemplifies the complexity of synthetic agrochemicals, balancing efficacy with environmental considerations.

Formula: C₁₃H₁₁F₃N₂O₂S

InChI: InChI=1S/C13H11F3N2O2S/c1-8-17-11(6-21-8)9-3-2-4-10(5-9)18-12(19)20-7-13(14,15)16/h2-6H,7H2,1H3,(H,18,19)

InChI key: InChIKey=WSCYFHSUUHNBFI-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C=1C=C(C=CC1)C=2N=C(C)SC2

Synonyms:

• 2,2,2-Trifluoroethyl N-[3-(2-methyl-4-thiazolyl)phenyl]carbamate
• 2,2,2-Trifluoroethyl N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate
• Carbamic acid, N-[3-(2-methyl-4-thiazolyl)phenyl]-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate

CAS: 1221724-56-6

Versatile small molecule scaffold

Formula: C₁₃H₁₁F₃N₂O₂S

Purity: Min. 95%

Molecular weight: 316.3 g/mol

Ref: 3D-WYB72456