CAS 1221724-59-9

Piperidine, 4-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)

Description:

Piperidine, 4-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the 3-methyl-1H-1,2,4-triazole moiety introduces additional heteroatoms and contributes to the compound's biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially including antimicrobial or antifungal activities, owing to the triazole group, which is known for its role in drug design. Its molecular structure suggests it could interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic applications.

Formula: C₈H₁₄N₄·2ClH

InChI: InChI=1S/C8H14N4.2ClH/c1-6-10-8(12-11-6)7-2-4-9-5-3-7;;/h7,9H,2-5H2,1H3,(H,10,11,12);2*1H

InChI key: InChIKey=NRKZSTHLHDSZLM-UHFFFAOYSA-N

SMILES: CC=1NC(=NN1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)

4-(5-Methyl-1H-1,2,4-triazol-3-yl)piperidine dihydrochloride

CAS: 1221724-59-9

Versatile small molecule scaffold

Formula: C₈H₁₆Cl₂N₄

Purity: Min. 95%

Molecular weight: 239.14 g/mol

Ref: 3D-WYB72459