CAS 1221724-70-4

4-Bromo-5-(chlorosulfonyl)-2-hydroxybenzoic acid

Description:

4-Bromo-5-(chlorosulfonyl)-2-hydroxybenzoic acid is an organic compound characterized by its complex structure, which includes a bromine atom, a chlorosulfonyl group, and a hydroxyl group attached to a benzoic acid framework. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl and sulfonyl functional groups. It exhibits acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of the bromine and chlorosulfonyl groups can enhance its reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks due to its reactive functional groups.

Formula: C₇H₄BrClO₅S

InChI: InChI=1S/C7H4BrClO5S/c8-4-2-5(10)3(7(11)12)1-6(4)15(9,13)14/h1-2,10H,(H,11,12)

InChI key: InChIKey=LBRWPXCVGDICPK-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC(C(O)=O)=C(O)C=C1Br

Synonyms:

• 4-Bromo-5-(chlorosulfonyl)-2-hydroxybenzoic acid
• Benzoic acid, 4-bromo-5-(chlorosulfonyl)-2-hydroxy-