CAS 1221724-81-7: 2-Thiazolecarboxylic acid, 4-(1-methylethyl)-, sodium salt (1:1)

Description: 2-Thiazolecarboxylic acid, 4-(1-methylethyl)-, sodium salt (1:1) is a chemical compound characterized by its thiazole ring structure, which contributes to its unique properties. This compound features a carboxylic acid functional group, making it acidic in nature, while the sodium salt form enhances its solubility in water. The presence of the isopropyl group (1-methylethyl) at the 4-position of the thiazole ring influences its reactivity and potential biological activity. Typically, compounds of this nature may exhibit antimicrobial or antifungal properties, making them of interest in pharmaceutical and agricultural applications. The sodium salt form often improves the stability and handling of the compound, allowing for easier incorporation into formulations. Additionally, the thiazole moiety is known for its involvement in various biochemical processes, which may suggest potential roles in metabolic pathways. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₇H₉NO₂S·Na

InChI: InChI=1S/C7H9NO2S.Na/c1-4(2)5-3-11-6(8-5)7(9)10;/h3-4H,1-2H3,(H,9,10);

InChI key: InChIKey=QSCSFDGXDMOAFT-UHFFFAOYSA-N

SMILES: [Na].O=C(O)C1=NC(=CS1)C(C)C

Synonyms:

• 2-Thiazolecarboxylic acid, 4-(1-methylethyl)-, sodium salt (1:1)

Sodium 4-(propan-2-yl)-1,3-thiazole-2-carboxylate

CAS: 1221724-81-7

Versatile small molecule scaffold

• Formula: C₇H₈NNaO₂S
• Purity: Min. 95%
• Molecular weight: 193.2 g/mol

Sodium 4-(propan-2-yl)-1,3-thiazole-2-carboxylate

CAS: 1221724-81-7

• Purity: 95%
• Molecular weight: 193.1999969482422